C19H20O5P+ — CID 172837062
hydroxy-[3-(2-methylprop-2-enoyloxy)-3,3-diphenylpropoxy]-oxophosphanium (PubChem CID 172837062) has the molecular formula C19H20O5P+ and a molecular weight of 359.34 g/mol. Its IUPAC name is hydroxy-[3-(2-methylprop-2-enoyloxy)-3,3-diphenylpropoxy]-oxophosphanium.
| Compound Name | hydroxy-[3-(2-methylprop-2-enoyloxy)-3,3-diphenylpropoxy]-oxophosphanium |
|---|---|
| PubChem CID | 172837062 |
| Molecular Formula | C19H20O5P+ |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | hydroxy-[3-(2-methylprop-2-enoyloxy)-3,3-diphenylpropoxy]-oxophosphanium |
| SMILES | C=C(C)C(=O)OC(CCO[P+](=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19O5P/c1-15(2)18(20)24-19(13-14-23-25(21)22,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12H,1,13-14H2,2H3/p+1 |
| InChIKey | OIKUAXQSRHKFRJ-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|