C21H24O5P+ — CID 172717545
hydroxy-[5-(2-methylprop-2-enoyloxy)-5,5-diphenylpentoxy]-oxophosphanium (PubChem CID 172717545) has the molecular formula C21H24O5P+ and a molecular weight of 387.39 g/mol. Its IUPAC name is hydroxy-[5-(2-methylprop-2-enoyloxy)-5,5-diphenylpentoxy]-oxophosphanium.
| Compound Name | hydroxy-[5-(2-methylprop-2-enoyloxy)-5,5-diphenylpentoxy]-oxophosphanium |
|---|---|
| PubChem CID | 172717545 |
| Molecular Formula | C21H24O5P+ |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | hydroxy-[5-(2-methylprop-2-enoyloxy)-5,5-diphenylpentoxy]-oxophosphanium |
| SMILES | C=C(C)C(=O)OC(CCCCO[P+](=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23O5P/c1-17(2)20(22)26-21(18-11-5-3-6-12-18,19-13-7-4-8-14-19)15-9-10-16-25-27(23)24/h3-8,11-14H,1,9-10,15-16H2,2H3/p+1 |
| InChIKey | QPDMIKVCIYXTHN-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|