C23H24O2P+ — CID 162300033
methyl-oxo-(4,4,4-triphenylbutoxy)phosphanium (PubChem CID 162300033) has the molecular formula C23H24O2P+ and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl-oxo-(4,4,4-triphenylbutoxy)phosphanium.
| Compound Name | methyl-oxo-(4,4,4-triphenylbutoxy)phosphanium |
|---|---|
| PubChem CID | 162300033 |
| Molecular Formula | C23H24O2P+ |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl-oxo-(4,4,4-triphenylbutoxy)phosphanium |
| SMILES | C[P+](=O)OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24O2P/c1-26(24)25-19-11-18-23(20-12-5-2-6-13-20,21-14-7-3-8-15-21)22-16-9-4-10-17-22/h2-10,12-17H,11,18-19H2,1H3/q+1 |
| InChIKey | PSNUTQMDVIJBLP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|