C23H25O3P — CID 173313082
carbonic acid;4,4,4-triphenylbutylphosphane (PubChem CID 173313082) has the molecular formula C23H25O3P and a molecular weight of 380.42 g/mol. Its IUPAC name is carbonic acid;4,4,4-triphenylbutylphosphane.
| Compound Name | carbonic acid;4,4,4-triphenylbutylphosphane |
|---|---|
| PubChem CID | 173313082 |
| Molecular Formula | C23H25O3P |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | carbonic acid;4,4,4-triphenylbutylphosphane |
| SMILES | O=C(O)O.PCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23P.CH2O3/c23-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2-1(3)4/h1-9,11-16H,10,17-18,23H2;(H2,2,3,4) |
| InChIKey | AWDNJKPBJZDUNT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|