C28H36BrP — CID 69307814
10,10,10-triphenyldecylphosphanium bromide (PubChem CID 69307814) has the molecular formula C28H36BrP and a molecular weight of 483.47 g/mol. Its IUPAC name is 10,10,10-triphenyldecylphosphanium bromide.
| Compound Name | 10,10,10-triphenyldecylphosphanium bromide |
|---|---|
| PubChem CID | 69307814 |
| Molecular Formula | C28H36BrP |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 10,10,10-triphenyldecylphosphanium bromide |
| SMILES | [Br-].[PH3+]CCCCCCCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35P.BrH/c29-24-16-5-3-1-2-4-15-23-28(25-17-9-6-10-18-25,26-19-11-7-12-20-26)27-21-13-8-14-22-27;/h6-14,17-22H,1-5,15-16,23-24,29H2;1H |
| InChIKey | XZTDYOOCHRZIDI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|