C27H30OP+ — CID 154191945
methylidene(8,8,8-triphenyloctanoyl)phosphanium (PubChem CID 154191945) has the molecular formula C27H30OP+ and a molecular weight of 401.51 g/mol. Its IUPAC name is methylidene(8,8,8-triphenyloctanoyl)phosphanium.
| Compound Name | methylidene(8,8,8-triphenyloctanoyl)phosphanium |
|---|---|
| PubChem CID | 154191945 |
| Molecular Formula | C27H30OP+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | methylidene(8,8,8-triphenyloctanoyl)phosphanium |
| SMILES | C=[PH+]C(=O)CCCCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29OP/c1-29-26(28)21-13-2-3-14-22-27(23-15-7-4-8-16-23,24-17-9-5-10-18-24)25-19-11-6-12-20-25/h4-12,15-20H,1-3,13-14,21-22H2/p+1 |
| InChIKey | COOFQJKZRSPTSJ-UHFFFAOYSA-O |
| XLogP | 7.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|