C20H20ClP — CID 21496958
2,2,2-triphenylethylphosphanium chloride (PubChem CID 21496958) has the molecular formula C20H20ClP and a molecular weight of 326.81 g/mol. Its IUPAC name is 2,2,2-triphenylethylphosphanium chloride.
| Compound Name | 2,2,2-triphenylethylphosphanium chloride |
|---|---|
| PubChem CID | 21496958 |
| Molecular Formula | C20H20ClP |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2,2,2-triphenylethylphosphanium chloride |
| SMILES | [Cl-].[PH3+]CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19P.ClH/c21-16-20(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-15H,16,21H2;1H |
| InChIKey | OZLRGRQCDARTFU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|