C20H19BrS — CID 172851267
2,2,2-triphenylethylsulfanium bromide (PubChem CID 172851267) has the molecular formula C20H19BrS and a molecular weight of 371.34 g/mol. Its IUPAC name is 2,2,2-triphenylethylsulfanium bromide.
| Compound Name | 2,2,2-triphenylethylsulfanium bromide |
|---|---|
| PubChem CID | 172851267 |
| Molecular Formula | C20H19BrS |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2,2,2-triphenylethylsulfanium bromide |
| SMILES | [Br-].[SH2+]CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18S.BrH/c21-16-20(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-15,21H,16H2;1H |
| InChIKey | YCFYWPXOIAPNPD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|