About tritylazanium iodide
tritylazanium iodide (PubChem CID 88708906) has the molecular formula C19H18IN
and a molecular weight of 387.26 g/mol. Its IUPAC name is tritylazanium iodide.
Molecular Properties
| Compound Name | tritylazanium iodide |
| PubChem CID | 88708906 |
| Molecular Formula | C19H18IN |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | tritylazanium iodide |
| SMILES | [I-].[NH3+]C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N.HI/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H,20H2;1H |
| InChIKey | VIXKZYNWMXZIFU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tritylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritylazanium iodide?
The IUPAC name of tritylazanium iodide (CID 88708906) is tritylazanium iodide.
What is the SMILES notation for tritylazanium iodide?
The canonical SMILES for tritylazanium iodide is [I-].[NH3+]C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tritylazanium iodide?
The InChIKey is VIXKZYNWMXZIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N.HI/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H,20H2;1H.
What are the key properties of tritylazanium iodide?
tritylazanium iodide has a molecular weight of 387.26 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tritylazanium iodide is sourced from PubChem (CID 88708906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).