C16H10Br10 — CID 159349505
1,1,2,2,2-pentabromoethylbenzene (PubChem CID 159349505) has the molecular formula C16H10Br10 and a molecular weight of 1001.30 g/mol. Its IUPAC name is 1,1,2,2,2-pentabromoethylbenzene.
| Compound Name | 1,1,2,2,2-pentabromoethylbenzene |
|---|---|
| PubChem CID | 159349505 |
| Molecular Formula | C16H10Br10 |
| Molecular Weight | 1001.30 g/mol |
| Exact Mass | 991.26 |
| IUPAC Name | 1,1,2,2,2-pentabromoethylbenzene |
| SMILES | BrC(Br)(Br)C(Br)(Br)c1ccccc1.BrC(Br)(Br)C(Br)(Br)c1ccccc1 |
| InChI | InChI=1S/2C8H5Br5/c2*9-7(10,8(11,12)13)6-4-2-1-3-5-6/h2*1-5H |
| InChIKey | LHDNTPXKKRXHHB-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.30 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|