C8H5Br2F3 — CID 12702818
(1,1-dibromo-2,2,2-trifluoroethyl)benzene (PubChem CID 12702818) has the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. Its IUPAC name is (1,1-dibromo-2,2,2-trifluoroethyl)benzene.
| Compound Name | (1,1-dibromo-2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 12702818 |
| Molecular Formula | C8H5Br2F3 |
| Molecular Weight | 317.93 g/mol |
| Exact Mass | 315.87 |
| IUPAC Name | (1,1-dibromo-2,2,2-trifluoroethyl)benzene |
| SMILES | FC(F)(F)C(Br)(Br)c1ccccc1 |
| InChI | InChI=1S/C8H5Br2F3/c9-7(10,8(11,12)13)6-4-2-1-3-5-6/h1-5H |
| InChIKey | XLRPMWUHLKHWST-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|