C14H10Cl2F2 — CID 15026496
(1,2-dichloro-1,2-difluoro-2-phenylethyl)benzene (PubChem CID 15026496) has the molecular formula C14H10Cl2F2 and a molecular weight of 287.14 g/mol. Its IUPAC name is (1,2-dichloro-1,2-difluoro-2-phenylethyl)benzene.
| Compound Name | (1,2-dichloro-1,2-difluoro-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 15026496 |
| Molecular Formula | C14H10Cl2F2 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | (1,2-dichloro-1,2-difluoro-2-phenylethyl)benzene |
| SMILES | FC(Cl)(c1ccccc1)C(F)(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2F2/c15-13(17,11-7-3-1-4-8-11)14(16,18)12-9-5-2-6-10-12/h1-10H |
| InChIKey | GSFDFTICJKBDRT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|