C17H10Cl10 — CID 154603995
(1,1,1,2,2,4,4,5,5,5-decachloro-3-phenylpentan-3-yl)benzene (PubChem CID 154603995) has the molecular formula C17H10Cl10 and a molecular weight of 568.80 g/mol. Its IUPAC name is (1,1,1,2,2,4,4,5,5,5-decachloro-3-phenylpentan-3-yl)benzene.
| Compound Name | (1,1,1,2,2,4,4,5,5,5-decachloro-3-phenylpentan-3-yl)benzene |
|---|---|
| PubChem CID | 154603995 |
| Molecular Formula | C17H10Cl10 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 563.77 |
| IUPAC Name | (1,1,1,2,2,4,4,5,5,5-decachloro-3-phenylpentan-3-yl)benzene |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)C(c1ccccc1)(c1ccccc1)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H10Cl10/c18-14(19,16(22,23)24)13(11-7-3-1-4-8-11,12-9-5-2-6-10-12)15(20,21)17(25,26)27/h1-10H |
| InChIKey | NXZOGJZTKLNMBL-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|