C29H19Cl17O — CID 57017434
[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecoxy(diphenyl)methyl]benzene (PubChem CID 57017434) has the molecular formula C29H19Cl17O and a molecular weight of 986.17 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecoxy(diphenyl)methyl]benzene.
| Compound Name | [3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecoxy(diphenyl)methyl]benzene |
|---|---|
| PubChem CID | 57017434 |
| Molecular Formula | C29H19Cl17O |
| Molecular Weight | 986.17 g/mol |
| Exact Mass | 977.61 |
| IUPAC Name | [3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecoxy(diphenyl)methyl]benzene |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H19Cl17O/c30-21(31,23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)28(42,43)29(44,45)46)16-17-47-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | RWUNIWQVUBBIEQ-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.17 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|