C9H5F6O- — CID 3796459
1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-olate (PubChem CID 3796459) has the molecular formula C9H5F6O- and a molecular weight of 243.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-olate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-olate |
|---|---|
| PubChem CID | 3796459 |
| Molecular Formula | C9H5F6O- |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-olate |
| SMILES | [O-]C(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F6O/c10-8(11,12)7(16,9(13,14)15)6-4-2-1-3-5-6/h1-5H/q-1 |
| InChIKey | PQYRNBNNXQDYEP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |