C17H16F3NO2S — CID 134952384
2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene (PubChem CID 134952384) has the molecular formula C17H16F3NO2S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene.
| Compound Name | 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene |
|---|---|
| PubChem CID | 134952384 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene |
| SMILES | O=[N+]([O-])C[C@](SCCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO2S/c18-17(19,20)16(13-21(22)23,15-9-5-2-6-10-15)24-12-11-14-7-3-1-4-8-14/h1-10H,11-13H2/t16-/m0/s1 |
| InChIKey | NIZVHYXHWAMFGO-INIZCTEOSA-N |
| XLogP | 4.70 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|