About 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene
2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene (PubChem CID 134952384) has the molecular formula C17H16F3NO2S
and a molecular weight of 355.38 g/mol. Its IUPAC name is 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene.
Molecular Properties
| Compound Name | 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene |
| PubChem CID | 134952384 |
| Molecular Formula | C17H16F3NO2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene |
| SMILES | O=[N+]([O-])C[C@](SCCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO2S/c18-17(19,20)16(13-21(22)23,15-9-5-2-6-10-15)24-12-11-14-7-3-1-4-8-14/h1-10H,11-13H2/t16-/m0/s1 |
| InChIKey | NIZVHYXHWAMFGO-INIZCTEOSA-N |
| XLogP | 4.70 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene?
The IUPAC name of 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene (CID 134952384) is 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene.
What is the SMILES notation for 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene?
The canonical SMILES for 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene is O=[N+]([O-])C[C@](SCCc1ccccc1)(c1ccccc1)C(F)(F)F.
What is the InChIKey of 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene?
The InChIKey is NIZVHYXHWAMFGO-INIZCTEOSA-N. The full InChI is InChI=1S/C17H16F3NO2S/c18-17(19,20)16(13-21(22)23,15-9-5-2-6-10-15)24-12-11-14-7-3-1-4-8-14/h1-10H,11-13H2/t16-/m0/s1.
What are the key properties of 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene?
2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene has a molecular weight of 355.38 g/mol, XLogP of 4.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-1,1,1-trifluoro-3-nitro-2-phenylpropan-2-yl]sulfanylethylbenzene is sourced from PubChem (CID 134952384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).