C8H7N3O6 — CID 18981522
1,1,2-trinitroethylbenzene (PubChem CID 18981522) has the molecular formula C8H7N3O6 and a molecular weight of 241.16 g/mol. Its IUPAC name is 1,1,2-trinitroethylbenzene.
| Compound Name | 1,1,2-trinitroethylbenzene |
|---|---|
| PubChem CID | 18981522 |
| Molecular Formula | C8H7N3O6 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 1,1,2-trinitroethylbenzene |
| SMILES | O=[N+]([O-])CC(c1ccccc1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O6/c12-9(13)6-8(10(14)15,11(16)17)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | NPFXTEAQSWJXCM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|