About (2,2-dinitro-2-phenylethyl) formate
(2,2-dinitro-2-phenylethyl) formate (PubChem CID 56982409) has the molecular formula C9H8N2O6
and a molecular weight of 240.17 g/mol. Its IUPAC name is (2,2-dinitro-2-phenylethyl) formate.
Molecular Properties
| Compound Name | (2,2-dinitro-2-phenylethyl) formate |
| PubChem CID | 56982409 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | (2,2-dinitro-2-phenylethyl) formate |
| SMILES | O=COCC(c1ccccc1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O6/c12-7-17-6-9(10(13)14,11(15)16)8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | GOQVLEBNPVQULP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dinitro-2-phenylethyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dinitro-2-phenylethyl) formate?
The IUPAC name of (2,2-dinitro-2-phenylethyl) formate (CID 56982409) is (2,2-dinitro-2-phenylethyl) formate.
What is the SMILES notation for (2,2-dinitro-2-phenylethyl) formate?
The canonical SMILES for (2,2-dinitro-2-phenylethyl) formate is O=COCC(c1ccccc1)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of (2,2-dinitro-2-phenylethyl) formate?
The InChIKey is GOQVLEBNPVQULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O6/c12-7-17-6-9(10(13)14,11(15)16)8-4-2-1-3-5-8/h1-5,7H,6H2.
What are the key properties of (2,2-dinitro-2-phenylethyl) formate?
(2,2-dinitro-2-phenylethyl) formate has a molecular weight of 240.17 g/mol, XLogP of 0.57, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dinitro-2-phenylethyl) formate is sourced from PubChem (CID 56982409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).