C10H11N9O12 — CID 131742679
trinitromethylbenzene;1,3,5-trinitro-1,3,5-triazinane (PubChem CID 131742679) has the molecular formula C10H11N9O12 and a molecular weight of 449.25 g/mol. Its IUPAC name is trinitromethylbenzene;1,3,5-trinitro-1,3,5-triazinane.
| Compound Name | trinitromethylbenzene;1,3,5-trinitro-1,3,5-triazinane |
|---|---|
| PubChem CID | 131742679 |
| Molecular Formula | C10H11N9O12 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | trinitromethylbenzene;1,3,5-trinitro-1,3,5-triazinane |
| SMILES | O=[N+]([O-])C(c1ccccc1)([N+](=O)[O-])[N+](=O)[O-].O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H5N3O6.C3H6N6O6/c11-8(12)7(9(13)14,10(15)16)6-4-2-1-3-5-6;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-5H;1-3H2 |
| InChIKey | JNKMWCSDALEPKZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 268.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|