C8H5AgN2O6 — CID 87172221
silver 2,2-dinitro-2-phenylacetate (PubChem CID 87172221) has the molecular formula C8H5AgN2O6 and a molecular weight of 333.00 g/mol. Its IUPAC name is silver 2,2-dinitro-2-phenylacetate.
| Compound Name | silver 2,2-dinitro-2-phenylacetate |
|---|---|
| PubChem CID | 87172221 |
| Molecular Formula | C8H5AgN2O6 |
| Molecular Weight | 333.00 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | silver 2,2-dinitro-2-phenylacetate |
| SMILES | O=C([O-])C(c1ccccc1)([N+](=O)[O-])[N+](=O)[O-].[Ag+] |
| InChI | InChI=1S/C8H6N2O6.Ag/c11-7(12)8(9(13)14,10(15)16)6-4-2-1-3-5-6;/h1-5H,(H,11,12);/q;+1/p-1 |
| InChIKey | OPRTZPXQFGVYIA-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.00 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|