C14H12ClO3- — CID 21418239
2-hydroxy-2,2-diphenylacetate;hydrochloride (PubChem CID 21418239) has the molecular formula C14H12ClO3- and a molecular weight of 263.70 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenylacetate;hydrochloride.
| Compound Name | 2-hydroxy-2,2-diphenylacetate;hydrochloride |
|---|---|
| PubChem CID | 21418239 |
| Molecular Formula | C14H12ClO3- |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-hydroxy-2,2-diphenylacetate;hydrochloride |
| SMILES | Cl.O=C([O-])C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3.ClH/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,17H,(H,15,16);1H/p-1 |
| InChIKey | PQYNIHOULQAQNH-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |