C26H39BrNO4- — CID 21120041
2-hydroxy-2,2-diphenylacetate;2-hydroxyethyl-dimethyl-octylazanium;bromide (PubChem CID 21120041) has the molecular formula C26H39BrNO4- and a molecular weight of 509.51 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenylacetate;2-hydroxyethyl-dimethyl-octylazanium;bromide.
| Compound Name | 2-hydroxy-2,2-diphenylacetate;2-hydroxyethyl-dimethyl-octylazanium;bromide |
|---|---|
| PubChem CID | 21120041 |
| Molecular Formula | C26H39BrNO4- |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 2-hydroxy-2,2-diphenylacetate;2-hydroxyethyl-dimethyl-octylazanium;bromide |
| SMILES | CCCCCCCC[N+](C)(C)CCO.O=C([O-])C(O)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C14H12O3.C12H28NO.BrH/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4-5-6-7-8-9-10-13(2,3)11-12-14;/h1-10,17H,(H,15,16);14H,4-12H2,1-3H3;1H/q;+1;/p-2 |
| InChIKey | LNYIEFKGWYJLDZ-UHFFFAOYSA-L |
| XLogP | 0.09 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|