C14H16Li2O4 — CID 139412066
dilithium;2-pentyl-2-phenylpropanedioate (PubChem CID 139412066) has the molecular formula C14H16Li2O4 and a molecular weight of 262.16 g/mol. Its IUPAC name is dilithium;2-pentyl-2-phenylpropanedioate.
| Compound Name | dilithium;2-pentyl-2-phenylpropanedioate |
|---|---|
| PubChem CID | 139412066 |
| Molecular Formula | C14H16Li2O4 |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | dilithium;2-pentyl-2-phenylpropanedioate |
| SMILES | CCCCCC(C(=O)[O-])(C(=O)[O-])c1ccccc1.[Li+].[Li+] |
| InChI | InChI=1S/C14H18O4.2Li/c1-2-3-7-10-14(12(15)16,13(17)18)11-8-5-4-6-9-11;;/h4-6,8-9H,2-3,7,10H2,1H3,(H,15,16)(H,17,18);;/q;2*+1/p-2 |
| InChIKey | WEFZUFBEZYLIPH-UHFFFAOYSA-L |
| XLogP | -5.99 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | -5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|