C13H14Li2O4 — CID 139411834
dilithium;2-butyl-2-phenylpropanedioate (PubChem CID 139411834) has the molecular formula C13H14Li2O4 and a molecular weight of 248.13 g/mol. Its IUPAC name is dilithium;2-butyl-2-phenylpropanedioate.
| Compound Name | dilithium;2-butyl-2-phenylpropanedioate |
|---|---|
| PubChem CID | 139411834 |
| Molecular Formula | C13H14Li2O4 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | dilithium;2-butyl-2-phenylpropanedioate |
| SMILES | CCCCC(C(=O)[O-])(C(=O)[O-])c1ccccc1.[Li+].[Li+] |
| InChI | InChI=1S/C13H16O4.2Li/c1-2-3-9-13(11(14)15,12(16)17)10-7-5-4-6-8-10;;/h4-8H,2-3,9H2,1H3,(H,14,15)(H,16,17);;/q;2*+1/p-2 |
| InChIKey | RABZICZNHSVSBD-UHFFFAOYSA-L |
| XLogP | -6.38 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | -6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|