C14H9Cl2KO3 — CID 102059899
potassium 2,2-bis(4-chlorophenyl)-2-hydroxyacetate (PubChem CID 102059899) has the molecular formula C14H9Cl2KO3 and a molecular weight of 335.23 g/mol. Its IUPAC name is potassium 2,2-bis(4-chlorophenyl)-2-hydroxyacetate.
| Compound Name | potassium 2,2-bis(4-chlorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 102059899 |
| Molecular Formula | C14H9Cl2KO3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | potassium 2,2-bis(4-chlorophenyl)-2-hydroxyacetate |
| SMILES | O=C([O-])C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C14H10Cl2O3.K/c15-11-5-1-9(2-6-11)14(19,13(17)18)10-3-7-12(16)8-4-10;/h1-8,19H,(H,17,18);/q;+1/p-1 |
| InChIKey | SLHZDKMIIJIKOW-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |