C32H28Cl4O6 — CID 160629016
ethyl 2,2-bis(4-chlorophenyl)-2-hydroxyacetate (PubChem CID 160629016) has the molecular formula C32H28Cl4O6 and a molecular weight of 650.38 g/mol. Its IUPAC name is ethyl 2,2-bis(4-chlorophenyl)-2-hydroxyacetate.
| Compound Name | ethyl 2,2-bis(4-chlorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 160629016 |
| Molecular Formula | C32H28Cl4O6 |
| Molecular Weight | 650.38 g/mol |
| Exact Mass | 648.06 |
| IUPAC Name | ethyl 2,2-bis(4-chlorophenyl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.CCOC(=O)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C16H14Cl2O3/c2*1-2-21-15(19)16(20,11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12/h2*3-10,20H,2H2,1H3 |
| InChIKey | RHRJQQPEAMKLIR-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.38 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |