C17H14Cl2N2O3 — CID 122366224
ethyl 3,3-bis(4-chlorophenyl)-2-diazo-3-hydroxypropanoate (PubChem CID 122366224) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is ethyl 3,3-bis(4-chlorophenyl)-2-diazo-3-hydroxypropanoate.
| Compound Name | ethyl 3,3-bis(4-chlorophenyl)-2-diazo-3-hydroxypropanoate |
|---|---|
| PubChem CID | 122366224 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | ethyl 3,3-bis(4-chlorophenyl)-2-diazo-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-2-24-16(22)15(21-20)17(23,11-3-7-13(18)8-4-11)12-5-9-14(19)10-6-12/h3-10,23H,2H2,1H3 |
| InChIKey | UXCMIQUEIWLWLL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|