C11H9ClF3NO2 — CID 15273554
ethyl 2-(4-chlorophenyl)imino-3,3,3-trifluoropropanoate (PubChem CID 15273554) has the molecular formula C11H9ClF3NO2 and a molecular weight of 279.65 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)imino-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(4-chlorophenyl)imino-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 15273554 |
| Molecular Formula | C11H9ClF3NO2 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)imino-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)/C(=N\c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H9ClF3NO2/c1-2-18-10(17)9(11(13,14)15)16-8-5-3-7(12)4-6-8/h3-6H,2H2,1H3/b16-9+ |
| InChIKey | PDXDSGRSKOBPBW-CXUHLZMHSA-N |
| XLogP | 3.54 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|