C12H10ClF3O2 — CID 11277437
ethyl (E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoate (PubChem CID 11277437) has the molecular formula C12H10ClF3O2 and a molecular weight of 278.66 g/mol. Its IUPAC name is ethyl (E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 11277437 |
| Molecular Formula | C12H10ClF3O2 |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | ethyl (E)-3-(4-chlorophenyl)-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(\c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3O2/c1-2-18-11(17)7-10(12(14,15)16)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3/b10-7+ |
| InChIKey | FMXMTQMZTDQWAQ-JXMROGBWSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|