C13H13F3O2 — CID 12063996
ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)but-2-enoate (PubChem CID 12063996) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)but-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)but-2-enoate |
|---|---|
| PubChem CID | 12063996 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-(4-methylphenyl)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O2/c1-3-18-12(17)8-11(13(14,15)16)10-6-4-9(2)5-7-10/h4-8H,3H2,1-2H3/b11-8+ |
| InChIKey | YXPPNOOGHDVGDM-DHZHZOJOSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|