C17H12BrF3O — CID 86685853
(Z)-3-(4-bromophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one (PubChem CID 86685853) has the molecular formula C17H12BrF3O and a molecular weight of 369.18 g/mol. Its IUPAC name is (Z)-3-(4-bromophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one.
| Compound Name | (Z)-3-(4-bromophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 86685853 |
| Molecular Formula | C17H12BrF3O |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | (Z)-3-(4-bromophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C(/c2ccc(Br)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12BrF3O/c1-11-2-4-13(5-3-11)16(22)10-15(17(19,20)21)12-6-8-14(18)9-7-12/h2-10H,1H3/b15-10- |
| InChIKey | LQAPAKXRLOYXLA-GDNBJRDFSA-N |
| XLogP | 5.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|