C18H11BrF6O — CID 87515366
(E)-1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one (PubChem CID 87515366) has the molecular formula C18H11BrF6O and a molecular weight of 437.18 g/mol. Its IUPAC name is (E)-1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 87515366 |
| Molecular Formula | C18H11BrF6O |
| Molecular Weight | 437.18 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | (E)-1-(4-bromo-3-methylphenyl)-4,4,4-trifluoro-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C(\c2cccc(C(F)(F)F)c2)C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C18H11BrF6O/c1-10-7-12(5-6-15(10)19)16(26)9-14(18(23,24)25)11-3-2-4-13(8-11)17(20,21)22/h2-9H,1H3/b14-9+ |
| InChIKey | FULGUSXOVWRKKK-NTEUORMPSA-N |
| XLogP | 6.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.18 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|