C18H8F12O2 — CID 159329806
2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 159329806) has the molecular formula C18H8F12O2 and a molecular weight of 484.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 159329806 |
| Molecular Formula | C18H8F12O2 |
| Molecular Weight | 484.24 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)C(F)(F)F.O=C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/2C9H4F6O/c2*10-8(11,12)6-3-1-2-5(4-6)7(16)9(13,14)15/h2*1-4H |
| InChIKey | LEVHYCUNVKULEM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.24 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |