C12H11F3O3 — CID 95048187
(2S)-2-[3-(trifluoromethyl)benzoyl]butanoic acid (PubChem CID 95048187) has the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is (2S)-2-[3-(trifluoromethyl)benzoyl]butanoic acid.
| Compound Name | (2S)-2-[3-(trifluoromethyl)benzoyl]butanoic acid |
|---|---|
| PubChem CID | 95048187 |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (2S)-2-[3-(trifluoromethyl)benzoyl]butanoic acid |
| SMILES | CC[C@H](C(=O)O)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3O3/c1-2-9(11(17)18)10(16)7-4-3-5-8(6-7)12(13,14)15/h3-6,9H,2H2,1H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | FGGCOSMBTHOIKP-VIFPVBQESA-N |
| XLogP | 3.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|