C18H21F3O4 — CID 57444486
ethyl 7-oxo-6-[3-(trifluoromethyl)benzoyl]octanoate (PubChem CID 57444486) has the molecular formula C18H21F3O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is ethyl 7-oxo-6-[3-(trifluoromethyl)benzoyl]octanoate.
| Compound Name | ethyl 7-oxo-6-[3-(trifluoromethyl)benzoyl]octanoate |
|---|---|
| PubChem CID | 57444486 |
| Molecular Formula | C18H21F3O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | ethyl 7-oxo-6-[3-(trifluoromethyl)benzoyl]octanoate |
| SMILES | CCOC(=O)CCCCC(C(C)=O)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F3O4/c1-3-25-16(23)10-5-4-9-15(12(2)22)17(24)13-7-6-8-14(11-13)18(19,20)21/h6-8,11,15H,3-5,9-10H2,1-2H3 |
| InChIKey | YVUCIRYDTFKTOO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|