C19H20F3N3O3 — CID 10548707
ethyl 5-[(E)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoate (PubChem CID 10548707) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is ethyl 5-[(E)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoate.
| Compound Name | ethyl 5-[(E)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoate |
|---|---|
| PubChem CID | 10548707 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 5-[(E)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoate |
| SMILES | CCOC(=O)CCCCO/N=C(\c1cccc(C(F)(F)F)c1)c1cccnn1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-2-27-17(26)10-3-4-12-28-25-18(16-9-6-11-23-24-16)14-7-5-8-15(13-14)19(20,21)22/h5-9,11,13H,2-4,10,12H2,1H3/b25-18+ |
| InChIKey | CEWPGZCTEFENLQ-XIEYBQDHSA-N |
| XLogP | 4.00 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|