C18H18F3N3O3 — CID 10762387
6-[(E)-[pyrimidin-4-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxyhexanoic acid (PubChem CID 10762387) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 6-[(E)-[pyrimidin-4-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxyhexanoic acid.
| Compound Name | 6-[(E)-[pyrimidin-4-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxyhexanoic acid |
|---|---|
| PubChem CID | 10762387 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 6-[(E)-[pyrimidin-4-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCO/N=C(\c1cccc(C(F)(F)F)c1)c1ccncn1 |
| InChI | InChI=1S/C18H18F3N3O3/c19-18(20,21)14-6-4-5-13(11-14)17(15-8-9-22-12-23-15)24-27-10-3-1-2-7-16(25)26/h4-6,8-9,11-12H,1-3,7,10H2,(H,25,26)/b24-17+ |
| InChIKey | JPHMJRKUPXGSTF-JJIBRWJFSA-N |
| XLogP | 3.91 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|