C17H16F3N3O3 — CID 23276767
5-[(Z)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoic acid (PubChem CID 23276767) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 5-[(Z)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoic acid.
| Compound Name | 5-[(Z)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoic acid |
|---|---|
| PubChem CID | 23276767 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-[(Z)-[pyridazin-3-yl-[3-(trifluoromethyl)phenyl]methylidene]amino]oxypentanoic acid |
| SMILES | O=C(O)CCCCO/N=C(/c1cccc(C(F)(F)F)c1)c1cccnn1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)13-6-3-5-12(11-13)16(14-7-4-9-21-22-14)23-26-10-2-1-8-15(24)25/h3-7,9,11H,1-2,8,10H2,(H,24,25)/b23-16- |
| InChIKey | DIPABBKYVMJJAH-KQWNVCNZSA-N |
| XLogP | 3.52 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|