C13H9F3N2O4 — CID 175527082
nitrous acid;2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid (PubChem CID 175527082) has the molecular formula C13H9F3N2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is nitrous acid;2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid.
| Compound Name | nitrous acid;2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 175527082 |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | nitrous acid;2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2cccc(C(F)(F)F)c2)c1.O=NO |
| InChI | InChI=1S/C13H8F3NO2.HNO2/c14-13(15,16)10-3-1-2-8(6-10)11-7-9(12(18)19)4-5-17-11;2-1-3/h1-7H,(H,18,19);(H,2,3) |
| InChIKey | BQROLEQXXOBEDW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|