About chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid
chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid (PubChem CID 159313551) has the molecular formula C14H10ClF4NO2
and a molecular weight of 335.68 g/mol. Its IUPAC name is chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid |
| PubChem CID | 159313551 |
| Molecular Formula | C14H10ClF4NO2 |
| Molecular Weight | 335.68 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid |
| SMILES | CCl.O=C(O)c1ccnc(-c2ccc(C(F)(F)F)cc2F)c1 |
| InChI | InChI=1S/C13H7F4NO2.CH3Cl/c14-10-6-8(13(15,16)17)1-2-9(10)11-5-7(12(19)20)3-4-18-11;1-2/h1-6H,(H,19,20);1H3 |
| InChIKey | LCVRKVGXTVABGE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid?
The IUPAC name of chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid (CID 159313551) is chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid.
What is the SMILES notation for chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid?
The canonical SMILES for chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid is CCl.O=C(O)c1ccnc(-c2ccc(C(F)(F)F)cc2F)c1.
What is the InChIKey of chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid?
The InChIKey is LCVRKVGXTVABGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F4NO2.CH3Cl/c14-10-6-8(13(15,16)17)1-2-9(10)11-5-7(12(19)20)3-4-18-11;1-2/h1-6H,(H,19,20);1H3.
What are the key properties of chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid?
chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid has a molecular weight of 335.68 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;2-[2-fluoro-4-(trifluoromethyl)phenyl]pyridine-4-carboxylic acid is sourced from PubChem (CID 159313551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).