C13H8F3NO3 — CID 50999403
2-[2-(trifluoromethoxy)phenyl]pyridine-4-carboxylic acid (PubChem CID 50999403) has the molecular formula C13H8F3NO3 and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-[2-(trifluoromethoxy)phenyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-(trifluoromethoxy)phenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 50999403 |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[2-(trifluoromethoxy)phenyl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F3NO3/c14-13(15,16)20-11-4-2-1-3-9(11)10-7-8(12(18)19)5-6-17-10/h1-7H,(H,18,19) |
| InChIKey | VKQUTWDSBGIORX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |