C21H13F6NO4 — CID 134618210
2-[2,6-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid (PubChem CID 134618210) has the molecular formula C21H13F6NO4 and a molecular weight of 457.33 g/mol. Its IUPAC name is 2-[2,6-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid.
| Compound Name | 2-[2,6-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134618210 |
| Molecular Formula | C21H13F6NO4 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-[2,6-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccccc2OC(F)(F)F)nc(-c2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F6NO4/c22-20(23,24)31-17-7-3-1-5-13(17)15-9-12(11-19(29)30)10-16(28-15)14-6-2-4-8-18(14)32-21(25,26)27/h1-10H,11H2,(H,29,30) |
| InChIKey | YNDXCDNEWVECGK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |