C14H9F4NO3 — CID 133089297
2-[5-fluoro-2-[2-(trifluoromethoxy)phenyl]-3-pyridinyl]acetic acid (PubChem CID 133089297) has the molecular formula C14H9F4NO3 and a molecular weight of 315.22 g/mol. Its IUPAC name is 2-[5-fluoro-2-[2-(trifluoromethoxy)phenyl]-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-fluoro-2-[2-(trifluoromethoxy)phenyl]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133089297 |
| Molecular Formula | C14H9F4NO3 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[5-fluoro-2-[2-(trifluoromethoxy)phenyl]-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(F)cnc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H9F4NO3/c15-9-5-8(6-12(20)21)13(19-7-9)10-3-1-2-4-11(10)22-14(16,17)18/h1-5,7H,6H2,(H,20,21) |
| InChIKey | XZSGBBLRTKLGDE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |