C15H12F3NO4 — CID 134620790
2-[2-methoxy-5-[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid (PubChem CID 134620790) has the molecular formula C15H12F3NO4 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-[2-methoxy-5-[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-methoxy-5-[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134620790 |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[2-methoxy-5-[2-(trifluoromethoxy)phenyl]-4-pyridinyl]acetic acid |
| SMILES | COc1cc(CC(=O)O)c(-c2ccccc2OC(F)(F)F)cn1 |
| InChI | InChI=1S/C15H12F3NO4/c1-22-13-6-9(7-14(20)21)11(8-19-13)10-4-2-3-5-12(10)23-15(16,17)18/h2-6,8H,7H2,1H3,(H,20,21) |
| InChIKey | QMWNMTIWCZXAEI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |