C20H13F6NO3 — CID 134617951
[2,5-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol (PubChem CID 134617951) has the molecular formula C20H13F6NO3 and a molecular weight of 429.32 g/mol. Its IUPAC name is [2,5-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol.
| Compound Name | [2,5-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134617951 |
| Molecular Formula | C20H13F6NO3 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [2,5-bis[2-(trifluoromethoxy)phenyl]-4-pyridinyl]methanol |
| SMILES | OCc1cc(-c2ccccc2OC(F)(F)F)ncc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H13F6NO3/c21-19(22,23)29-17-7-3-1-5-13(17)15-10-27-16(9-12(15)11-28)14-6-2-4-8-18(14)30-20(24,25)26/h1-10,28H,11H2 |
| InChIKey | ZOYOFSIBLZVXOO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |