C15H10F6O2 — CID 172649054
[2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)phenyl]methanol (PubChem CID 172649054) has the molecular formula C15H10F6O2 and a molecular weight of 336.23 g/mol. Its IUPAC name is [2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 172649054 |
| Molecular Formula | C15H10F6O2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1cc(C(F)(F)F)ccc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H10F6O2/c16-14(17,18)10-5-6-11(9(7-10)8-22)12-3-1-2-4-13(12)23-15(19,20)21/h1-7,22H,8H2 |
| InChIKey | DZVZTFXCCBLTMF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |