C15H9F6NO3 — CID 134621231
2-[3-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 134621231) has the molecular formula C15H9F6NO3 and a molecular weight of 365.23 g/mol. Its IUPAC name is 2-[3-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[3-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134621231 |
| Molecular Formula | C15H9F6NO3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-[3-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1ncc(C(F)(F)F)cc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H9F6NO3/c16-14(17,18)8-5-10(11(22-7-8)6-13(23)24)9-3-1-2-4-12(9)25-15(19,20)21/h1-5,7H,6H2,(H,23,24) |
| InChIKey | DRAOZONRSIYUNT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |