C15H9F6NO2 — CID 134628859
2-[5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid (PubChem CID 134628859) has the molecular formula C15H9F6NO2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134628859 |
| Molecular Formula | C15H9F6NO2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-[5-(trifluoromethyl)-2-[2-(trifluoromethyl)phenyl]-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)(F)F)cnc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H9F6NO2/c16-14(17,18)9-5-8(6-12(23)24)13(22-7-9)10-3-1-2-4-11(10)15(19,20)21/h1-5,7H,6H2,(H,23,24) |
| InChIKey | UIHAKOFHKRQYTB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |