C13H7F4NO2 — CID 133089659
5-fluoro-2-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 133089659) has the molecular formula C13H7F4NO2 and a molecular weight of 285.20 g/mol. Its IUPAC name is 5-fluoro-2-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 133089659 |
| Molecular Formula | C13H7F4NO2 |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-fluoro-2-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H7F4NO2/c14-7-5-9(12(19)20)11(18-6-7)8-3-1-2-4-10(8)13(15,16)17/h1-6H,(H,19,20) |
| InChIKey | JVQLOZIKCYSZAK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |