C14H7F6NO3 — CID 118819339
2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 118819339) has the molecular formula C14H7F6NO3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118819339 |
| Molecular Formula | C14H7F6NO3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-[2-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)cnc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H7F6NO3/c15-13(16,17)7-5-9(12(22)23)11(21-6-7)8-3-1-2-4-10(8)24-14(18,19)20/h1-6H,(H,22,23) |
| InChIKey | QACSLZPSOUNVKX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |